C22H29N7O2S — CID 3744269
N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3744269) has the molecular formula C22H29N7O2S and a molecular weight of 455.59 g/mol. Its IUPAC name is N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3744269 |
| Molecular Formula | C22H29N7O2S |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC1(C)C(C(=O)N2CCC(c3nc(C(=O)NN=C(N)c4cnccn4)cs3)CC2)C1(C)C |
| InChI | InChI=1S/C22H29N7O2S/c1-21(2)16(22(21,3)4)20(31)29-9-5-13(6-10-29)19-26-15(12-32-19)18(30)28-27-17(23)14-11-24-7-8-25-14/h7-8,11-13,16H,5-6,9-10H2,1-4H3,(H2,23,27)(H,28,30) |
| InChIKey | DEOWNSXHYKPOMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|