C24H29ClN4O3S — CID 3586423
N'-(2-chlorobenzoyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 3586423) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3586423 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N'-(2-chlorobenzoyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | CC1(C)C(C(=O)N2CCC(c3nc(C(=O)NNC(=O)c4ccccc4Cl)cs3)CC2)C1(C)C |
| InChI | InChI=1S/C24H29ClN4O3S/c1-23(2)18(24(23,3)4)22(32)29-11-9-14(10-12-29)21-26-17(13-33-21)20(31)28-27-19(30)15-7-5-6-8-16(15)25/h5-8,13-14,18H,9-12H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | SGFCADZQLFEUMS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|