C23H23ClN4O3S2 — CID 3254871
2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3254871) has the molecular formula C23H23ClN4O3S2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3254871 |
| Molecular Formula | C23H23ClN4O3S2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2csc(C3CCN(C(=O)Cc4ccccc4Cl)CC3)n2)s1 |
| InChI | InChI=1S/C23H23ClN4O3S2/c1-14-6-7-19(33-14)22(31)27-26-21(30)18-13-32-23(25-18)15-8-10-28(11-9-15)20(29)12-16-4-2-3-5-17(16)24/h2-7,13,15H,8-12H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | SAZKVRODSWUVAZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|