C25H30N4O2S2 — CID 3833664
N-(2-methyl-1,3-benzothiazol-5-yl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3833664) has the molecular formula C25H30N4O2S2 and a molecular weight of 482.68 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-5-yl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-5-yl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3833664 |
| Molecular Formula | C25H30N4O2S2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-5-yl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3csc(C4CCN(C(=O)C5C(C)(C)C5(C)C)CC4)n3)ccc2s1 |
| InChI | InChI=1S/C25H30N4O2S2/c1-14-26-17-12-16(6-7-19(17)33-14)27-21(30)18-13-32-22(28-18)15-8-10-29(11-9-15)23(31)20-24(2,3)25(20,4)5/h6-7,12-13,15,20H,8-11H2,1-5H3,(H,27,30) |
| InChIKey | OIUJYCBMKFLNOS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |