C23H29N5O3S — CID 3248199
N'-(pyridine-4-carbonyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 3248199) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is N'-(pyridine-4-carbonyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(pyridine-4-carbonyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3248199 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N'-(pyridine-4-carbonyl)-2-[1-(2,2,3,3-tetramethylcyclopropanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | CC1(C)C(C(=O)N2CCC(c3nc(C(=O)NNC(=O)c4ccncc4)cs3)CC2)C1(C)C |
| InChI | InChI=1S/C23H29N5O3S/c1-22(2)17(23(22,3)4)21(31)28-11-7-15(8-12-28)20-25-16(13-32-20)19(30)27-26-18(29)14-5-9-24-10-6-14/h5-6,9-10,13,15,17H,7-8,11-12H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | KTLKAMLUHHRVJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|