C25H28F3N3O2S — CID 3807473
N-[2-(cyclohexen-1-yl)ethyl]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3807473) has the molecular formula C25H28F3N3O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3807473 |
| Molecular Formula | C25H28F3N3O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1csc(C2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C25H28F3N3O2S/c26-25(27,28)20-9-5-4-8-19(20)24(33)31-14-11-18(12-15-31)23-30-21(16-34-23)22(32)29-13-10-17-6-2-1-3-7-17/h4-6,8-9,16,18H,1-3,7,10-15H2,(H,29,32) |
| InChIKey | ZMAOIOMRHPOFOG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|