C25H29F3N4O3S — CID 5018874
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 5018874) has the molecular formula C25H29F3N4O3S and a molecular weight of 522.59 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 5018874 |
| Molecular Formula | C25H29F3N4O3S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C25H29F3N4O3S/c26-25(27,28)35-20-8-4-7-19(15-20)30-22(33)21-16-36-23(31-21)18-10-13-32(14-11-18)24(34)29-12-9-17-5-2-1-3-6-17/h4-5,7-8,15-16,18H,1-3,6,9-14H2,(H,29,34)(H,30,33) |
| InChIKey | VDLDTAIJJWNLAH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|