C25H26F3N5O2S2 — CID 3831170
2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 3831170) has the molecular formula C25H26F3N5O2S2 and a molecular weight of 549.64 g/mol. Its IUPAC name is 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3831170 |
| Molecular Formula | C25H26F3N5O2S2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-[3-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)Nc4cccc(OC(F)(F)F)c4)cs3)CC2)cc1 |
| InChI | InChI=1S/C25H26F3N5O2S2/c1-32(2)19-8-6-17(7-9-19)30-24(36)33-12-10-16(11-13-33)23-31-21(15-37-23)22(34)29-18-4-3-5-20(14-18)35-25(26,27)28/h3-9,14-16H,10-13H2,1-2H3,(H,29,34)(H,30,36) |
| InChIKey | ARKDTVSRFINFQB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|