C23H27N5OS3 — CID 3854790
2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(thiophen-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3854790) has the molecular formula C23H27N5OS3 and a molecular weight of 485.70 g/mol. Its IUPAC name is 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(thiophen-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(thiophen-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3854790 |
| Molecular Formula | C23H27N5OS3 |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(thiophen-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)NCc4cccs4)cs3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5OS3/c1-27(2)18-7-5-17(6-8-18)25-23(30)28-11-9-16(10-12-28)22-26-20(15-32-22)21(29)24-14-19-4-3-13-31-19/h3-8,13,15-16H,9-12,14H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | YBHHGAGSPUZQGL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|