C23H31N5O3S3 — CID 3795285
2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 3795285) has the molecular formula C23H31N5O3S3 and a molecular weight of 521.73 g/mol. Its IUPAC name is 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3795285 |
| Molecular Formula | C23H31N5O3S3 |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(1,1-dioxothiolan-3-yl)-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)N(C)C4CCS(=O)(=O)C4)cs3)CC2)cc1 |
| InChI | InChI=1S/C23H31N5O3S3/c1-26(2)18-6-4-17(5-7-18)24-23(32)28-11-8-16(9-12-28)21-25-20(14-33-21)22(29)27(3)19-10-13-34(30,31)15-19/h4-7,14,16,19H,8-13,15H2,1-3H3,(H,24,32) |
| InChIKey | CJYYYJQSIHBHOM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|