C26H30N6O3S2 — CID 3540063
N-[4-(dimethylamino)phenyl]-4-[4-[[(2-methoxybenzoyl)amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide (PubChem CID 3540063) has the molecular formula C26H30N6O3S2 and a molecular weight of 538.70 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[4-[[(2-methoxybenzoyl)amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[4-[[(2-methoxybenzoyl)amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3540063 |
| Molecular Formula | C26H30N6O3S2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[4-[[(2-methoxybenzoyl)amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
| SMILES | COc1ccccc1C(=O)NNC(=O)c1csc(C2CCN(C(=S)Nc3ccc(N(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C26H30N6O3S2/c1-31(2)19-10-8-18(9-11-19)27-26(36)32-14-12-17(13-15-32)25-28-21(16-37-25)24(34)30-29-23(33)20-6-4-5-7-22(20)35-3/h4-11,16-17H,12-15H2,1-3H3,(H,27,36)(H,29,33)(H,30,34) |
| InChIKey | HRIAUSZHMQQRSE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|