C22H25N5O4S — CID 3329151
prop-2-ynyl 4-[4-[[[4-(dimethylamino)benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3329151) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-[[[4-(dimethylamino)benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-[[[4-(dimethylamino)benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3329151 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | prop-2-ynyl 4-[4-[[[4-(dimethylamino)benzoyl]amino]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCC(c2nc(C(=O)NNC(=O)c3ccc(N(C)C)cc3)cs2)CC1 |
| InChI | InChI=1S/C22H25N5O4S/c1-4-13-31-22(30)27-11-9-16(10-12-27)21-23-18(14-32-21)20(29)25-24-19(28)15-5-7-17(8-6-15)26(2)3/h1,5-8,14,16H,9-13H2,2-3H3,(H,24,28)(H,25,29) |
| InChIKey | HMUCQKAFYBSXNF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|