C19H24N4O3S3 — CID 3293058
prop-2-ynyl 4-[4-[2-(cyclopropylcarbamothioylsulfanyl)ethylcarbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3293058) has the molecular formula C19H24N4O3S3 and a molecular weight of 452.63 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-[2-(cyclopropylcarbamothioylsulfanyl)ethylcarbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-[2-(cyclopropylcarbamothioylsulfanyl)ethylcarbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3293058 |
| Molecular Formula | C19H24N4O3S3 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | prop-2-ynyl 4-[4-[2-(cyclopropylcarbamothioylsulfanyl)ethylcarbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCC(c2nc(C(=O)NCCSC(=S)NC3CC3)cs2)CC1 |
| InChI | InChI=1S/C19H24N4O3S3/c1-2-10-26-19(25)23-8-5-13(6-9-23)17-22-15(12-29-17)16(24)20-7-11-28-18(27)21-14-3-4-14/h1,12-14H,3-11H2,(H,20,24)(H,21,27) |
| InChIKey | GDBFGUIOGCGJJS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|