C21H27N3O5S — CID 3691311
prop-2-ynyl 4-[4-(4-ethoxycarbonylpiperidine-1-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3691311) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-(4-ethoxycarbonylpiperidine-1-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-(4-ethoxycarbonylpiperidine-1-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3691311 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | prop-2-ynyl 4-[4-(4-ethoxycarbonylpiperidine-1-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCC(c2nc(C(=O)N3CCC(C(=O)OCC)CC3)cs2)CC1 |
| InChI | InChI=1S/C21H27N3O5S/c1-3-13-29-21(27)24-11-5-15(6-12-24)18-22-17(14-30-18)19(25)23-9-7-16(8-10-23)20(26)28-4-2/h1,14-16H,4-13H2,2H3 |
| InChIKey | OWAMPTFGIMUOMU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|