C19H19N5O4S — CID 3459681
prop-2-ynyl 4-[4-[(pyridine-3-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3459681) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-[(pyridine-3-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-[(pyridine-3-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3459681 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | prop-2-ynyl 4-[4-[(pyridine-3-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCC(c2nc(C(=O)NNC(=O)c3cccnc3)cs2)CC1 |
| InChI | InChI=1S/C19H19N5O4S/c1-2-10-28-19(27)24-8-5-13(6-9-24)18-21-15(12-29-18)17(26)23-22-16(25)14-4-3-7-20-11-14/h1,3-4,7,11-13H,5-6,8-10H2,(H,22,25)(H,23,26) |
| InChIKey | WPGWKZMGXORVIW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|