C19H21N3O3S2 — CID 3385715
prop-2-ynyl 4-[4-(2-thiophen-2-ylethylcarbamoyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3385715) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is prop-2-ynyl 4-[4-(2-thiophen-2-ylethylcarbamoyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | prop-2-ynyl 4-[4-(2-thiophen-2-ylethylcarbamoyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3385715 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | prop-2-ynyl 4-[4-(2-thiophen-2-ylethylcarbamoyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C#CCOC(=O)N1CCC(c2nc(C(=O)NCCc3cccs3)cs2)CC1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-2-11-25-19(24)22-9-6-14(7-10-22)18-21-16(13-27-18)17(23)20-8-5-15-4-3-12-26-15/h1,3-4,12-14H,5-11H2,(H,20,23) |
| InChIKey | JQSFDFNWCOKPQK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|