C26H27N5O5S — CID 3699076
2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N'-(pyridine-3-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3699076) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N'-(pyridine-3-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N'-(pyridine-3-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3699076 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N'-(pyridine-3-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | COc1ccc(C(=O)CCC(=O)N2CCC(c3nc(C(=O)NNC(=O)c4cccnc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O5S/c1-36-20-6-4-17(5-7-20)22(32)8-9-23(33)31-13-10-18(11-14-31)26-28-21(16-37-26)25(35)30-29-24(34)19-3-2-12-27-15-19/h2-7,12,15-16,18H,8-11,13-14H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | BMYLMVWOVVLKOE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|