C24H27N3O5S2 — CID 3872297
2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 3872297) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3872297 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[1-[4-(4-methoxyphenyl)-4-oxobutanoyl]piperidin-4-yl]-N-(2-oxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)CCC(=O)N2CCC(c3nc(C(=O)NC4CCSC4=O)cs3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-32-17-4-2-15(3-5-17)20(28)6-7-21(29)27-11-8-16(9-12-27)23-26-19(14-34-23)22(30)25-18-10-13-33-24(18)31/h2-5,14,16,18H,6-13H2,1H3,(H,25,30) |
| InChIKey | OOQYHCUTZLGOTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|