C27H31Cl2N7OS2 — CID 3643946
4-[4-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide (PubChem CID 3643946) has the molecular formula C27H31Cl2N7OS2 and a molecular weight of 604.63 g/mol. Its IUPAC name is 4-[4-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-[4-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3643946 |
| Molecular Formula | C27H31Cl2N7OS2 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 4-[4-[4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)N4CCN(c5c(Cl)cncc5Cl)CC4)cs3)CC2)cc1 |
| InChI | InChI=1S/C27H31Cl2N7OS2/c1-33(2)20-5-3-19(4-6-20)31-27(38)36-9-7-18(8-10-36)25-32-23(17-39-25)26(37)35-13-11-34(12-14-35)24-21(28)15-30-16-22(24)29/h3-6,15-18H,7-14H2,1-2H3,(H,31,38) |
| InChIKey | JAKIQPUHOFQGHX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|