C30H38N6O3S2 — CID 3845720
4-[4-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide (PubChem CID 3845720) has the molecular formula C30H38N6O3S2 and a molecular weight of 594.81 g/mol. Its IUPAC name is 4-[4-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-[4-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3845720 |
| Molecular Formula | C30H38N6O3S2 |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 4-[4-[4-(2,4-dimethoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3csc(C4CCN(C(=S)Nc5ccc(N(C)C)cc5)CC4)n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C30H38N6O3S2/c1-33(2)23-7-5-22(6-8-23)31-30(40)36-13-11-21(12-14-36)28-32-25(20-41-28)29(37)35-17-15-34(16-18-35)26-10-9-24(38-3)19-27(26)39-4/h5-10,19-21H,11-18H2,1-4H3,(H,31,40) |
| InChIKey | JDEYSLUEZNIJRX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|