C28H34N6O2S2 — CID 3563251
2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 3563251) has the molecular formula C28H34N6O2S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3563251 |
| Molecular Formula | C28H34N6O2S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)Nc4ccccc4N4CCOCC4)cs3)CC2)cc1 |
| InChI | InChI=1S/C28H34N6O2S2/c1-32(2)22-9-7-21(8-10-22)29-28(37)34-13-11-20(12-14-34)27-31-24(19-38-27)26(35)30-23-5-3-4-6-25(23)33-15-17-36-18-16-33/h3-10,19-20H,11-18H2,1-2H3,(H,29,37)(H,30,35) |
| InChIKey | ZRAWSUWTZXUSMY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|