C25H32N4O2S2 — CID 59210075
2-[1-(3-cyclopropylpropanethioyl)piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 59210075) has the molecular formula C25H32N4O2S2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 2-[1-(3-cyclopropylpropanethioyl)piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(3-cyclopropylpropanethioyl)piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210075 |
| Molecular Formula | C25H32N4O2S2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-[1-(3-cyclopropylpropanethioyl)piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1csc(C2CCN(C(=S)CCC3CC3)CC2)n1 |
| InChI | InChI=1S/C25H32N4O2S2/c30-24(26-20-3-1-2-4-22(20)28-13-15-31-16-14-28)21-17-33-25(27-21)19-9-11-29(12-10-19)23(32)8-7-18-5-6-18/h1-4,17-19H,5-16H2,(H,26,30) |
| InChIKey | HFZNTDHFFFYOTQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|