C26H37N5O2S — CID 59210136
2-[1-(pentylcarbamoyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 59210136) has the molecular formula C26H37N5O2S and a molecular weight of 483.68 g/mol. Its IUPAC name is 2-[1-(pentylcarbamoyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(pentylcarbamoyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210136 |
| Molecular Formula | C26H37N5O2S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 2-[1-(pentylcarbamoyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3N3CCCCC3)cs2)CC1 |
| InChI | InChI=1S/C26H37N5O2S/c1-2-3-7-14-27-26(33)31-17-12-20(13-18-31)25-29-22(19-34-25)24(32)28-21-10-5-6-11-23(21)30-15-8-4-9-16-30/h5-6,10-11,19-20H,2-4,7-9,12-18H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | PVLLKNYOUQYFAH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|