C27H37N3O2S — CID 71025985
2-(4-hexanoylcyclohexyl)-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 71025985) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is 2-(4-hexanoylcyclohexyl)-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-hexanoylcyclohexyl)-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71025985 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(4-hexanoylcyclohexyl)-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCC(=O)C1CCC(c2nc(C(=O)Nc3ccccc3N3CCCCC3)cs2)CC1 |
| InChI | InChI=1S/C27H37N3O2S/c1-2-3-5-12-25(31)20-13-15-21(16-14-20)27-29-23(19-33-27)26(32)28-22-10-6-7-11-24(22)30-17-8-4-9-18-30/h6-7,10-11,19-21H,2-5,8-9,12-18H2,1H3,(H,28,32) |
| InChIKey | VGQSZCGWZACTHV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|