C25H32N4O3S — CID 59210334
but-3-enyl 4-[4-[(2-piperidin-1-ylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 59210334) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is but-3-enyl 4-[4-[(2-piperidin-1-ylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | but-3-enyl 4-[4-[(2-piperidin-1-ylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59210334 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | but-3-enyl 4-[4-[(2-piperidin-1-ylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C=CCCOC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3N3CCCCC3)cs2)CC1 |
| InChI | InChI=1S/C25H32N4O3S/c1-2-3-17-32-25(31)29-15-11-19(12-16-29)24-27-21(18-33-24)23(30)26-20-9-5-6-10-22(20)28-13-7-4-8-14-28/h2,5-6,9-10,18-19H,1,3-4,7-8,11-17H2,(H,26,30) |
| InChIKey | RULLTSCVRAEXNV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|