C24H31N5OS2 — CID 59209195
N-(2-piperidin-1-ylphenyl)-2-[1-(prop-2-enylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209195) has the molecular formula C24H31N5OS2 and a molecular weight of 469.68 g/mol. Its IUPAC name is N-(2-piperidin-1-ylphenyl)-2-[1-(prop-2-enylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-piperidin-1-ylphenyl)-2-[1-(prop-2-enylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209195 |
| Molecular Formula | C24H31N5OS2 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(2-piperidin-1-ylphenyl)-2-[1-(prop-2-enylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C=CCNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3N3CCCCC3)cs2)CC1 |
| InChI | InChI=1S/C24H31N5OS2/c1-2-12-25-24(31)29-15-10-18(11-16-29)23-27-20(17-32-23)22(30)26-19-8-4-5-9-21(19)28-13-6-3-7-14-28/h2,4-5,8-9,17-18H,1,3,6-7,10-16H2,(H,25,31)(H,26,30) |
| InChIKey | AKYSGCLNUCCBHP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|