C26H31N5O2S2 — CID 59209980
2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 59209980) has the molecular formula C26H31N5O2S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209980 |
| Molecular Formula | C26H31N5O2S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1csc(C2CCN(C(=S)NCc3ccco3)CC2)n1 |
| InChI | InChI=1S/C26H31N5O2S2/c32-24(28-21-8-2-3-9-23(21)30-12-4-1-5-13-30)22-18-35-25(29-22)19-10-14-31(15-11-19)26(34)27-17-20-7-6-16-33-20/h2-3,6-9,16,18-19H,1,4-5,10-15,17H2,(H,27,34)(H,28,32) |
| InChIKey | QBXRTFUSFJZTDW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|