C27H25FN4O2S2 — CID 89090218
N-[2-(4-fluorophenyl)phenyl]-2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 89090218) has the molecular formula C27H25FN4O2S2 and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)phenyl]-2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89090218 |
| Molecular Formula | C27H25FN4O2S2 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(furan-2-ylmethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccc(F)cc1)c1csc(C2CCN(C(=S)NCc3ccco3)CC2)n1 |
| InChI | InChI=1S/C27H25FN4O2S2/c28-20-9-7-18(8-10-20)22-5-1-2-6-23(22)30-25(33)24-17-36-26(31-24)19-11-13-32(14-12-19)27(35)29-16-21-4-3-15-34-21/h1-10,15,17,19H,11-14,16H2,(H,29,35)(H,30,33) |
| InChIKey | DQMZJVWQKKDBEI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|