C24H25FN4O2S2 — CID 59209586
N-[2-(4-fluorophenyl)phenyl]-2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209586) has the molecular formula C24H25FN4O2S2 and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)phenyl]-2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209586 |
| Molecular Formula | C24H25FN4O2S2 |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COCNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C24H25FN4O2S2/c1-31-15-26-24(32)29-12-10-17(11-13-29)23-28-21(14-33-23)22(30)27-20-5-3-2-4-19(20)16-6-8-18(25)9-7-16/h2-9,14,17H,10-13,15H2,1H3,(H,26,32)(H,27,30) |
| InChIKey | DXNXJBVWBRMXJZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|