C24H26N4O2S2 — CID 59209245
2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-N-(2-phenylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 59209245) has the molecular formula C24H26N4O2S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-N-(2-phenylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-N-(2-phenylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209245 |
| Molecular Formula | C24H26N4O2S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-[1-(methoxymethylcarbamothioyl)piperidin-4-yl]-N-(2-phenylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C24H26N4O2S2/c1-30-16-25-24(31)28-13-11-18(12-14-28)23-27-21(15-32-23)22(29)26-20-10-6-5-9-19(20)17-7-3-2-4-8-17/h2-10,15,18H,11-14,16H2,1H3,(H,25,31)(H,26,29) |
| InChIKey | FVCKXZGKSNVZFU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|