C27H28N4OS2 — CID 59210081
N-[2-(4-ethylphenyl)phenyl]-2-[1-(prop-2-ynylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59210081) has the molecular formula C27H28N4OS2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)phenyl]-2-[1-(prop-2-ynylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-ethylphenyl)phenyl]-2-[1-(prop-2-ynylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210081 |
| Molecular Formula | C27H28N4OS2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[2-(4-ethylphenyl)phenyl]-2-[1-(prop-2-ynylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C#CCNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(CC)cc3)cs2)CC1 |
| InChI | InChI=1S/C27H28N4OS2/c1-3-15-28-27(33)31-16-13-21(14-17-31)26-30-24(18-34-26)25(32)29-23-8-6-5-7-22(23)20-11-9-19(4-2)10-12-20/h1,5-12,18,21H,4,13-17H2,2H3,(H,28,33)(H,29,32) |
| InChIKey | ZIXBLMMTTBDNBC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|