C29H36N4OS2 — CID 59209556
N-[2-(4-ethylphenyl)phenyl]-2-[1-(3-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209556) has the molecular formula C29H36N4OS2 and a molecular weight of 520.77 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)phenyl]-2-[1-(3-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-ethylphenyl)phenyl]-2-[1-(3-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209556 |
| Molecular Formula | C29H36N4OS2 |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[2-(4-ethylphenyl)phenyl]-2-[1-(3-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCc1ccc(-c2ccccc2NC(=O)c2csc(C3CCN(C(=S)NCCC(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C29H36N4OS2/c1-4-21-9-11-22(12-10-21)24-7-5-6-8-25(24)31-27(34)26-19-36-28(32-26)23-14-17-33(18-15-23)29(35)30-16-13-20(2)3/h5-12,19-20,23H,4,13-18H2,1-3H3,(H,30,35)(H,31,34) |
| InChIKey | PWRASFXOIUIEPC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|