C27H31FN4OS2 — CID 59209712
N-[2-(4-fluorophenyl)phenyl]-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209712) has the molecular formula C27H31FN4OS2 and a molecular weight of 510.70 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)phenyl]-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209712 |
| Molecular Formula | C27H31FN4OS2 |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[2-(4-fluorophenyl)phenyl]-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)CNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C27H31FN4OS2/c1-3-18(2)16-29-27(34)32-14-12-20(13-15-32)26-31-24(17-35-26)25(33)30-23-7-5-4-6-22(23)19-8-10-21(28)11-9-19/h4-11,17-18,20H,3,12-16H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | MCTNTMLWJWZFSF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|