C28H34N4O2S2 — CID 59208650
N-(5-methoxy-2-phenylphenyl)-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59208650) has the molecular formula C28H34N4O2S2 and a molecular weight of 522.74 g/mol. Its IUPAC name is N-(5-methoxy-2-phenylphenyl)-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-methoxy-2-phenylphenyl)-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59208650 |
| Molecular Formula | C28H34N4O2S2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N-(5-methoxy-2-phenylphenyl)-2-[1-(2-methylbutylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)CNC(=S)N1CCC(c2nc(C(=O)Nc3cc(OC)ccc3-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C28H34N4O2S2/c1-4-19(2)17-29-28(35)32-14-12-21(13-15-32)27-31-25(18-36-27)26(33)30-24-16-22(34-3)10-11-23(24)20-8-6-5-7-9-20/h5-11,16,18-19,21H,4,12-15,17H2,1-3H3,(H,29,35)(H,30,33) |
| InChIKey | WLOOGADWEGXZMT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|