C27H33N3O2S — CID 59209312
N-(5-methoxy-2-phenylphenyl)-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 59209312) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is N-(5-methoxy-2-phenylphenyl)-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-methoxy-2-phenylphenyl)-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209312 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-(5-methoxy-2-phenylphenyl)-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCN1CCC(c2nc(C(=O)Nc3cc(OC)ccc3-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C27H33N3O2S/c1-3-4-8-15-30-16-13-21(14-17-30)27-29-25(19-33-27)26(31)28-24-18-22(32-2)11-12-23(24)20-9-6-5-7-10-20/h5-7,9-12,18-19,21H,3-4,8,13-17H2,1-2H3,(H,28,31) |
| InChIKey | DBVODXVZHZWCJB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|