C25H30N4OS2 — CID 89200240
N-[2-(4-aminophenyl)phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 89200240) has the molecular formula C25H30N4OS2 and a molecular weight of 466.68 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-aminophenyl)phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89200240 |
| Molecular Formula | C25H30N4OS2 |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[2-(4-aminophenyl)phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CSCCCN1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(N)cc3)cs2)CC1 |
| InChI | InChI=1S/C25H30N4OS2/c1-31-16-4-13-29-14-11-19(12-15-29)25-28-23(17-32-25)24(30)27-22-6-3-2-5-21(22)18-7-9-20(26)10-8-18/h2-3,5-10,17,19H,4,11-16,26H2,1H3,(H,27,30) |
| InChIKey | HHYKSCDWSCKKSD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|