C27H31F2N3OS2 — CID 142983158
N-[2-[3-(1,1-difluoroethyl)phenyl]phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 142983158) has the molecular formula C27H31F2N3OS2 and a molecular weight of 515.70 g/mol. Its IUPAC name is N-[2-[3-(1,1-difluoroethyl)phenyl]phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[3-(1,1-difluoroethyl)phenyl]phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142983158 |
| Molecular Formula | C27H31F2N3OS2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[2-[3-(1,1-difluoroethyl)phenyl]phenyl]-2-[1-(3-methylsulfanylpropyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CSCCCN1CCC(c2nc(C(=O)Nc3ccccc3-c3cccc(C(C)(F)F)c3)cs2)CC1 |
| InChI | InChI=1S/C27H31F2N3OS2/c1-27(28,29)21-8-5-7-20(17-21)22-9-3-4-10-23(22)30-25(33)24-18-35-26(31-24)19-11-14-32(15-12-19)13-6-16-34-2/h3-5,7-10,17-19H,6,11-16H2,1-2H3,(H,30,33) |
| InChIKey | VOQDGKLOLLIOFI-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|