C27H28F3N3O3S — CID 59209500
butyl 4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 59209500) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is butyl 4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59209500 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | butyl 4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3cccc(C(F)(F)F)c3)cs2)CC1 |
| InChI | InChI=1S/C27H28F3N3O3S/c1-2-3-15-36-26(35)33-13-11-18(12-14-33)25-32-23(17-37-25)24(34)31-22-10-5-4-9-21(22)19-7-6-8-20(16-19)27(28,29)30/h4-10,16-18H,2-3,11-15H2,1H3,(H,31,34) |
| InChIKey | IYQAIOBOBKRQTL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|