C27H26F3N3O3S2 — CID 59208831
methyl 2-[[4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]cyclohexanecarbothioyl]amino]acetate (PubChem CID 59208831) has the molecular formula C27H26F3N3O3S2 and a molecular weight of 561.65 g/mol. Its IUPAC name is methyl 2-[[4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]cyclohexanecarbothioyl]amino]acetate.
| Compound Name | methyl 2-[[4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]cyclohexanecarbothioyl]amino]acetate |
|---|---|
| PubChem CID | 59208831 |
| Molecular Formula | C27H26F3N3O3S2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | methyl 2-[[4-[4-[[2-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]-1,3-thiazol-2-yl]cyclohexanecarbothioyl]amino]acetate |
| SMILES | COC(=O)CNC(=S)C1CCC(c2nc(C(=O)Nc3ccccc3-c3cccc(C(F)(F)F)c3)cs2)CC1 |
| InChI | InChI=1S/C27H26F3N3O3S2/c1-36-23(34)14-31-25(37)16-9-11-17(12-10-16)26-33-22(15-38-26)24(35)32-21-8-3-2-7-20(21)18-5-4-6-19(13-18)27(28,29)30/h2-8,13,15-17H,9-12,14H2,1H3,(H,31,37)(H,32,35) |
| InChIKey | JWUNIMBRIWWBEO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|