C27H29F3N4O2S — CID 70908059
2-[1-(butylcarbamoyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 70908059) has the molecular formula C27H29F3N4O2S and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[1-(butylcarbamoyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(butylcarbamoyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70908059 |
| Molecular Formula | C27H29F3N4O2S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 2-[1-(butylcarbamoyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3cccc(C(F)(F)F)c3)cs2)CC1 |
| InChI | InChI=1S/C27H29F3N4O2S/c1-2-3-13-31-26(36)34-14-11-18(12-15-34)25-33-23(17-37-25)24(35)32-22-10-5-4-9-21(22)19-7-6-8-20(16-19)27(28,29)30/h4-10,16-18H,2-3,11-15H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | IKMIAVRFFAVWAF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|