C27H30F3N3O2S — CID 59210108
2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 59210108) has the molecular formula C27H30F3N3O2S and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210108 |
| Molecular Formula | C27H30F3N3O2S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-[3-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1cccc(C(F)(F)F)c1)c1csc(C2CCN(CCCCCO)CC2)n1 |
| InChI | InChI=1S/C27H30F3N3O2S/c28-27(29,30)21-8-6-7-20(17-21)22-9-2-3-10-23(22)31-25(35)24-18-36-26(32-24)19-11-14-33(15-12-19)13-4-1-5-16-34/h2-3,6-10,17-19,34H,1,4-5,11-16H2,(H,31,35) |
| InChIKey | MUANMBVASUIIID-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|