C25H33F3N4O2S — CID 59210289
2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 59210289) has the molecular formula C25H33F3N4O2S and a molecular weight of 510.63 g/mol. Its IUPAC name is 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210289 |
| Molecular Formula | C25H33F3N4O2S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[1-(5-hydroxypentyl)piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1csc(C2CCN(CCCCCO)CC2)n1 |
| InChI | InChI=1S/C25H33F3N4O2S/c26-25(27,28)19-6-7-22(32-11-3-4-12-32)20(16-19)29-23(34)21-17-35-24(30-21)18-8-13-31(14-9-18)10-2-1-5-15-33/h6-7,16-18,33H,1-5,8-15H2,(H,29,34) |
| InChIKey | SUPMPPUNBHIZIX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|