C29H22F20N4O2S — CID 89090241
2-[1-[2,2,3,4,4,6,6,6-octafluoro-3,5,5-tris(trifluoromethyl)hexanoyl]piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 89090241) has the molecular formula C29H22F20N4O2S and a molecular weight of 870.55 g/mol. Its IUPAC name is 2-[1-[2,2,3,4,4,6,6,6-octafluoro-3,5,5-tris(trifluoromethyl)hexanoyl]piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2,2,3,4,4,6,6,6-octafluoro-3,5,5-tris(trifluoromethyl)hexanoyl]piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89090241 |
| Molecular Formula | C29H22F20N4O2S |
| Molecular Weight | 870.55 g/mol |
| Exact Mass | 870.11 |
| IUPAC Name | 2-[1-[2,2,3,4,4,6,6,6-octafluoro-3,5,5-tris(trifluoromethyl)hexanoyl]piperidin-4-yl]-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)c1csc(C2CCN(C(=O)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C29H22F20N4O2S/c30-21(31,24(35,29(47,48)49)25(36,37)23(26(38,39)40,27(41,42)43)28(44,45)46)20(55)53-9-5-13(6-10-53)19-51-16(12-56-19)18(54)50-15-11-14(22(32,33)34)3-4-17(15)52-7-1-2-8-52/h3-4,11-13H,1-2,5-10H2,(H,50,54) |
| InChIKey | QRJSUUXHXSEYED-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.55 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |