C26H28N4O3S2 — CID 142982607
methyl 2-[[4-[4-[[2-(4-methylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate (PubChem CID 142982607) has the molecular formula C26H28N4O3S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is methyl 2-[[4-[4-[[2-(4-methylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate.
| Compound Name | methyl 2-[[4-[4-[[2-(4-methylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate |
|---|---|
| PubChem CID | 142982607 |
| Molecular Formula | C26H28N4O3S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | methyl 2-[[4-[4-[[2-(4-methylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate |
| SMILES | COC(=O)CNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(C)cc3)cs2)CC1 |
| InChI | InChI=1S/C26H28N4O3S2/c1-17-7-9-18(10-8-17)20-5-3-4-6-21(20)28-24(32)22-16-35-25(29-22)19-11-13-30(14-12-19)26(34)27-15-23(31)33-2/h3-10,16,19H,11-15H2,1-2H3,(H,27,34)(H,28,32) |
| InChIKey | KUVDQDZEDNMYCW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|