C27H30N4O3S2 — CID 59209995
ethyl 2-[[4-[4-[(4-methyl-2-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate (PubChem CID 59209995) has the molecular formula C27H30N4O3S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is ethyl 2-[[4-[4-[(4-methyl-2-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[4-[(4-methyl-2-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate |
|---|---|
| PubChem CID | 59209995 |
| Molecular Formula | C27H30N4O3S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | ethyl 2-[[4-[4-[(4-methyl-2-phenylphenyl)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carbothioyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=S)N1CCC(c2nc(C(=O)Nc3ccc(C)cc3-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C27H30N4O3S2/c1-3-34-24(32)16-28-27(35)31-13-11-20(12-14-31)26-30-23(17-36-26)25(33)29-22-10-9-18(2)15-21(22)19-7-5-4-6-8-19/h4-10,15,17,20H,3,11-14,16H2,1-2H3,(H,28,35)(H,29,33) |
| InChIKey | YYZWBKOQSAMXNH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|