C24H24ClFN4OS2 — CID 59210130
N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59210130) has the molecular formula C24H24ClFN4OS2 and a molecular weight of 503.07 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210130 |
| Molecular Formula | C24H24ClFN4OS2 |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=S)N1CCC(c2nc(C(=O)Nc3ccc(F)cc3-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C24H24ClFN4OS2/c1-2-27-24(32)30-11-9-16(10-12-30)23-29-21(14-33-23)22(31)28-20-8-7-18(26)13-19(20)15-3-5-17(25)6-4-15/h3-8,13-14,16H,2,9-12H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | MEZSQUIMJPFVOZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|