C27H27ClFN3O2S — CID 59209724
N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-(1-hex-5-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 59209724) has the molecular formula C27H27ClFN3O2S and a molecular weight of 512.05 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-(1-hex-5-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-(1-hex-5-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209724 |
| Molecular Formula | C27H27ClFN3O2S |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-fluorophenyl]-2-(1-hex-5-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C=CCCCC(=O)N1CCC(c2nc(C(=O)Nc3ccc(F)cc3-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C27H27ClFN3O2S/c1-2-3-4-5-25(33)32-14-12-19(13-15-32)27-31-24(17-35-27)26(34)30-23-11-10-21(29)16-22(23)18-6-8-20(28)9-7-18/h2,6-11,16-17,19H,1,3-5,12-15H2,(H,30,34) |
| InChIKey | UZLKMDXAVGKBKI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|