C28H31N3O2S — CID 59209919
2-(1-hex-5-enoylpiperidin-4-yl)-N-[2-(4-methylphenyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 59209919) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-(1-hex-5-enoylpiperidin-4-yl)-N-[2-(4-methylphenyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-hex-5-enoylpiperidin-4-yl)-N-[2-(4-methylphenyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209919 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 2-(1-hex-5-enoylpiperidin-4-yl)-N-[2-(4-methylphenyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | C=CCCCC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(C)cc3)cs2)CC1 |
| InChI | InChI=1S/C28H31N3O2S/c1-3-4-5-10-26(32)31-17-15-22(16-18-31)28-30-25(19-34-28)27(33)29-24-9-7-6-8-23(24)21-13-11-20(2)12-14-21/h3,6-9,11-14,19,22H,1,4-5,10,15-18H2,2H3,(H,29,33) |
| InChIKey | LSMUOSRUXNWZIJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|