C26H25N3O3S — CID 142983144
N-[2-(4-hydroxyphenyl)phenyl]-2-(1-pent-4-ynoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 142983144) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)phenyl]-2-(1-pent-4-ynoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)phenyl]-2-(1-pent-4-ynoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142983144 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)phenyl]-2-(1-pent-4-ynoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C#CCCC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(O)cc3)cs2)CC1 |
| InChI | InChI=1S/C26H25N3O3S/c1-2-3-8-24(31)29-15-13-19(14-16-29)26-28-23(17-33-26)25(32)27-22-7-5-4-6-21(22)18-9-11-20(30)12-10-18/h1,4-7,9-12,17,19,30H,3,8,13-16H2,(H,27,32) |
| InChIKey | JDMMYAPQWZOMDV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|