C26H26FN3O2S — CID 59209028
N-[2-(4-fluorophenyl)phenyl]-2-(1-pent-4-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 59209028) has the molecular formula C26H26FN3O2S and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)phenyl]-2-(1-pent-4-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)phenyl]-2-(1-pent-4-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209028 |
| Molecular Formula | C26H26FN3O2S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)phenyl]-2-(1-pent-4-enoylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C=CCCC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C26H26FN3O2S/c1-2-3-8-24(31)30-15-13-19(14-16-30)26-29-23(17-33-26)25(32)28-22-7-5-4-6-21(22)18-9-11-20(27)12-10-18/h2,4-7,9-12,17,19H,1,3,8,13-16H2,(H,28,32) |
| InChIKey | DRYGURIALPMXIM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|